C28H23NO7 — CID 124719433
[4-[2-[2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenoxy]acetyl]phenyl] furan-2-carboxylate (PubChem CID 124719433) has the molecular formula C28H23NO7 and a molecular weight of 485.49 g/mol. Its IUPAC name is [4-[2-[2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenoxy]acetyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[2-[2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenoxy]acetyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 124719433 |
| Molecular Formula | C28H23NO7 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [4-[2-[2-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenoxy]acetyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(COc1ccccc1N1C(=O)[C@@H]2[C@H]3CC[C@@H](C3)[C@H]2C1=O)c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C28H23NO7/c30-21(16-9-11-19(12-10-16)36-28(33)23-6-3-13-34-23)15-35-22-5-2-1-4-20(22)29-26(31)24-17-7-8-18(14-17)25(24)27(29)32/h1-6,9-13,17-18,24-25H,7-8,14-15H2/t17-,18-,24+,25+/m0/s1 |
| InChIKey | HCWLDIVIPJRQMB-WFDFDODZSA-N |
| XLogP | 4.30 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|