C26H21BrCl2N2O3 — CID 19646516
N-(4-bromo-2-methylphenyl)-2,4-dichloro-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]benzamide (PubChem CID 19646516) has the molecular formula C26H21BrCl2N2O3 and a molecular weight of 560.28 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2,4-dichloro-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]benzamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2,4-dichloro-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 19646516 |
| Molecular Formula | C26H21BrCl2N2O3 |
| Molecular Weight | 560.28 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2,4-dichloro-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]benzamide |
| SMILES | Cc1cc(Br)ccc1N(CN1C(=O)C2C3C=CC(C4CC34)C2C1=O)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H21BrCl2N2O3/c1-12-8-13(27)2-7-21(12)30(24(32)17-4-3-14(28)9-20(17)29)11-31-25(33)22-15-5-6-16(19-10-18(15)19)23(22)26(31)34/h2-9,15-16,18-19,22-23H,10-11H2,1H3 |
| InChIKey | HWMKWEHOYJDTPI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.28 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|