C20H28N2O2S — CID 19651148
1-(4-methyl-2-oxochromen-7-yl)-3-nonylthiourea (PubChem CID 19651148) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is 1-(4-methyl-2-oxochromen-7-yl)-3-nonylthiourea.
| Compound Name | 1-(4-methyl-2-oxochromen-7-yl)-3-nonylthiourea |
|---|---|
| PubChem CID | 19651148 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-(4-methyl-2-oxochromen-7-yl)-3-nonylthiourea |
| SMILES | CCCCCCCCCNC(=S)Nc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H28N2O2S/c1-3-4-5-6-7-8-9-12-21-20(25)22-16-10-11-17-15(2)13-19(23)24-18(17)14-16/h10-11,13-14H,3-9,12H2,1-2H3,(H2,21,22,25) |
| InChIKey | PZTYPAUAJQQKJW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|