C23H34N2O2S — CID 19653426
1,1-dihexyl-3-(4-methyl-2-oxochromen-7-yl)thiourea (PubChem CID 19653426) has the molecular formula C23H34N2O2S and a molecular weight of 402.60 g/mol. Its IUPAC name is 1,1-dihexyl-3-(4-methyl-2-oxochromen-7-yl)thiourea.
| Compound Name | 1,1-dihexyl-3-(4-methyl-2-oxochromen-7-yl)thiourea |
|---|---|
| PubChem CID | 19653426 |
| Molecular Formula | C23H34N2O2S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1,1-dihexyl-3-(4-methyl-2-oxochromen-7-yl)thiourea |
| SMILES | CCCCCCN(CCCCCC)C(=S)Nc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H34N2O2S/c1-4-6-8-10-14-25(15-11-9-7-5-2)23(28)24-19-12-13-20-18(3)16-22(26)27-21(20)17-19/h12-13,16-17H,4-11,14-15H2,1-3H3,(H,24,28) |
| InChIKey | VRWVJQBMVGHTHO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|