About 3-cyclopentyl-1,1-diethylthiourea
3-cyclopentyl-1,1-diethylthiourea (PubChem CID 19652948) has the molecular formula C10H20N2S
and a molecular weight of 200.35 g/mol. Its IUPAC name is 3-cyclopentyl-1,1-diethylthiourea.
Molecular Properties
| Compound Name | 3-cyclopentyl-1,1-diethylthiourea |
| PubChem CID | 19652948 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-cyclopentyl-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)NC1CCCC1 |
| InChI | InChI=1S/C10H20N2S/c1-3-12(4-2)10(13)11-9-7-5-6-8-9/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | CBHDPKZGQDNFLQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentyl-1,1-diethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1,1-diethylthiourea?
The IUPAC name of 3-cyclopentyl-1,1-diethylthiourea (CID 19652948) is 3-cyclopentyl-1,1-diethylthiourea.
What is the SMILES notation for 3-cyclopentyl-1,1-diethylthiourea?
The canonical SMILES for 3-cyclopentyl-1,1-diethylthiourea is CCN(CC)C(=S)NC1CCCC1.
What is the InChIKey of 3-cyclopentyl-1,1-diethylthiourea?
The InChIKey is CBHDPKZGQDNFLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2S/c1-3-12(4-2)10(13)11-9-7-5-6-8-9/h9H,3-8H2,1-2H3,(H,11,13).
What are the key properties of 3-cyclopentyl-1,1-diethylthiourea?
3-cyclopentyl-1,1-diethylthiourea has a molecular weight of 200.35 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1,1-diethylthiourea is sourced from PubChem (CID 19652948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).