C10H20N2S — CID 19652948
3-cyclopentyl-1,1-diethylthiourea (PubChem CID 19652948) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 3-cyclopentyl-1,1-diethylthiourea.
| Compound Name | 3-cyclopentyl-1,1-diethylthiourea |
|---|---|
| PubChem CID | 19652948 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-cyclopentyl-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)NC1CCCC1 |
| InChI | InChI=1S/C10H20N2S/c1-3-12(4-2)10(13)11-9-7-5-6-8-9/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | CBHDPKZGQDNFLQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|