C17H23F2N3OS — CID 2462702
2-[cyclohexylcarbamothioyl(ethyl)amino]-N-(2,6-difluorophenyl)acetamide (PubChem CID 2462702) has the molecular formula C17H23F2N3OS and a molecular weight of 355.45 g/mol. Its IUPAC name is 2-[cyclohexylcarbamothioyl(ethyl)amino]-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-[cyclohexylcarbamothioyl(ethyl)amino]-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 2462702 |
| Molecular Formula | C17H23F2N3OS |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[cyclohexylcarbamothioyl(ethyl)amino]-N-(2,6-difluorophenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(=S)NC1CCCCC1 |
| InChI | InChI=1S/C17H23F2N3OS/c1-2-22(17(24)20-12-7-4-3-5-8-12)11-15(23)21-16-13(18)9-6-10-14(16)19/h6,9-10,12H,2-5,7-8,11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | AFYLNHCNKROTDY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|