C16H23N3O3S2 — CID 19653754
ethyl 2-(morpholin-4-ylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19653754) has the molecular formula C16H23N3O3S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is ethyl 2-(morpholin-4-ylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-(morpholin-4-ylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19653754 |
| Molecular Formula | C16H23N3O3S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethyl 2-(morpholin-4-ylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NN2CCOCC2)sc2c1CCCC2 |
| InChI | InChI=1S/C16H23N3O3S2/c1-2-22-15(20)13-11-5-3-4-6-12(11)24-14(13)17-16(23)18-19-7-9-21-10-8-19/h2-10H2,1H3,(H2,17,18,23) |
| InChIKey | WYONRFQGHHMJBD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|