C26H26BrN3O4 — CID 19659166
N'-[(E)-[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2,5-dimethylphenyl)oxamide (PubChem CID 19659166) has the molecular formula C26H26BrN3O4 and a molecular weight of 524.42 g/mol. Its IUPAC name is N'-[(E)-[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2,5-dimethylphenyl)oxamide.
| Compound Name | N'-[(E)-[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2,5-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 19659166 |
| Molecular Formula | C26H26BrN3O4 |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | N'-[(E)-[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2,5-dimethylphenyl)oxamide |
| SMILES | COc1cc(/C=N/NC(=O)C(=O)Nc2cc(C)ccc2C)cc(Br)c1OCc1ccccc1C |
| InChI | InChI=1S/C26H26BrN3O4/c1-16-9-10-18(3)22(11-16)29-25(31)26(32)30-28-14-19-12-21(27)24(23(13-19)33-4)34-15-20-8-6-5-7-17(20)2/h5-14H,15H2,1-4H3,(H,29,31)(H,30,32)/b28-14+ |
| InChIKey | FFEIZCFRJABMGE-CCVNUDIWSA-N |
| XLogP | 5.05 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|