C29H25N3O5S — CID 19660442
methyl 2-[[2-[(2E)-2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19660442) has the molecular formula C29H25N3O5S and a molecular weight of 527.60 g/mol. Its IUPAC name is methyl 2-[[2-[(2E)-2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(2E)-2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19660442 |
| Molecular Formula | C29H25N3O5S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | methyl 2-[[2-[(2E)-2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(=O)N/N=C/c2cccc(OCc3cccc4ccccc34)c2)sc2c1CCC2 |
| InChI | InChI=1S/C29H25N3O5S/c1-36-29(35)25-23-13-6-14-24(23)38-28(25)31-26(33)27(34)32-30-16-18-7-4-11-21(15-18)37-17-20-10-5-9-19-8-2-3-12-22(19)20/h2-5,7-12,15-16H,6,13-14,17H2,1H3,(H,31,33)(H,32,34)/b30-16+ |
| InChIKey | VUYCHRMDAQTUHO-OKCVXOCRSA-N |
| XLogP | 4.84 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|