C19H14Br3NO3 — CID 19663038
(4Z)-2-(4-bromophenyl)-4-[(3,5-dibromo-4-propan-2-yloxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19663038) has the molecular formula C19H14Br3NO3 and a molecular weight of 544.04 g/mol. Its IUPAC name is (4Z)-2-(4-bromophenyl)-4-[(3,5-dibromo-4-propan-2-yloxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-bromophenyl)-4-[(3,5-dibromo-4-propan-2-yloxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19663038 |
| Molecular Formula | C19H14Br3NO3 |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 540.85 |
| IUPAC Name | (4Z)-2-(4-bromophenyl)-4-[(3,5-dibromo-4-propan-2-yloxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CC(C)Oc1c(Br)cc(/C=C2\N=C(c3ccc(Br)cc3)OC2=O)cc1Br |
| InChI | InChI=1S/C19H14Br3NO3/c1-10(2)25-17-14(21)7-11(8-15(17)22)9-16-19(24)26-18(23-16)12-3-5-13(20)6-4-12/h3-10H,1-2H3/b16-9- |
| InChIKey | MRYUHCBOJJLPQH-SXGWCWSVSA-N |
| XLogP | 6.11 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|