C20H16BrNO4 — CID 19669242
[4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate (PubChem CID 19669242) has the molecular formula C20H16BrNO4 and a molecular weight of 414.26 g/mol. Its IUPAC name is [4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate.
| Compound Name | [4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate |
|---|---|
| PubChem CID | 19669242 |
| Molecular Formula | C20H16BrNO4 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | [4-[(Z)-[2-(2-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(/C=C2\N=C(c3ccccc3Br)OC2=O)cc1 |
| InChI | InChI=1S/C20H16BrNO4/c1-2-5-18(23)25-14-10-8-13(9-11-14)12-17-20(24)26-19(22-17)15-6-3-4-7-16(15)21/h3-4,6-12H,2,5H2,1H3/b17-12- |
| InChIKey | QQSKWXPIWCQERL-ATVHPVEESA-N |
| XLogP | 4.50 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|