C20H17BrINO3 — CID 19671371
(4Z)-2-(3-bromo-4-iodophenyl)-4-[(3-butoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19671371) has the molecular formula C20H17BrINO3 and a molecular weight of 526.17 g/mol. Its IUPAC name is (4Z)-2-(3-bromo-4-iodophenyl)-4-[(3-butoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-bromo-4-iodophenyl)-4-[(3-butoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19671371 |
| Molecular Formula | C20H17BrINO3 |
| Molecular Weight | 526.17 g/mol |
| Exact Mass | 524.94 |
| IUPAC Name | (4Z)-2-(3-bromo-4-iodophenyl)-4-[(3-butoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCCCOc1cccc(/C=C2\N=C(c3ccc(I)c(Br)c3)OC2=O)c1 |
| InChI | InChI=1S/C20H17BrINO3/c1-2-3-9-25-15-6-4-5-13(10-15)11-18-20(24)26-19(23-18)14-7-8-17(22)16(21)12-14/h4-8,10-12H,2-3,9H2,1H3/b18-11- |
| InChIKey | HVHGZAPOCQYNBC-WQRHYEAKSA-N |
| XLogP | 5.58 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.17 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|