C20H15BrINO4 — CID 19671119
[3-[(Z)-[2-(3-bromo-4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate (PubChem CID 19671119) has the molecular formula C20H15BrINO4 and a molecular weight of 540.15 g/mol. Its IUPAC name is [3-[(Z)-[2-(3-bromo-4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate.
| Compound Name | [3-[(Z)-[2-(3-bromo-4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate |
|---|---|
| PubChem CID | 19671119 |
| Molecular Formula | C20H15BrINO4 |
| Molecular Weight | 540.15 g/mol |
| Exact Mass | 538.92 |
| IUPAC Name | [3-[(Z)-[2-(3-bromo-4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1cccc(/C=C2\N=C(c3ccc(I)c(Br)c3)OC2=O)c1 |
| InChI | InChI=1S/C20H15BrINO4/c1-2-4-18(24)26-14-6-3-5-12(9-14)10-17-20(25)27-19(23-17)13-7-8-16(22)15(21)11-13/h3,5-11H,2,4H2,1H3/b17-10- |
| InChIKey | LMSFBFHZKPKBRS-YVLHZVERSA-N |
| XLogP | 5.10 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.15 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|