C25H18BrClINO4 — CID 19673730
(4Z)-4-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(2-chloro-5-iodophenyl)-1,3-oxazol-5-one (PubChem CID 19673730) has the molecular formula C25H18BrClINO4 and a molecular weight of 638.68 g/mol. Its IUPAC name is (4Z)-4-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(2-chloro-5-iodophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(2-chloro-5-iodophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19673730 |
| Molecular Formula | C25H18BrClINO4 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 636.92 |
| IUPAC Name | (4Z)-4-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(2-chloro-5-iodophenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1cc(/C=C2\N=C(c3cc(I)ccc3Cl)OC2=O)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H18BrClINO4/c1-2-31-23-12-16(5-10-22(23)32-14-15-3-6-17(26)7-4-15)11-21-25(30)33-24(29-21)19-13-18(28)8-9-20(19)27/h3-13H,2,14H2,1H3/b21-11- |
| InChIKey | YVEJEDKOJTVKLA-NHDPSOOVSA-N |
| XLogP | 7.03 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|