C24H16ClI2NO4 — CID 19673793
(4Z)-2-(2-chloro-5-iodophenyl)-4-[[4-[(2-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 19673793) has the molecular formula C24H16ClI2NO4 and a molecular weight of 671.66 g/mol. Its IUPAC name is (4Z)-2-(2-chloro-5-iodophenyl)-4-[[4-[(2-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-chloro-5-iodophenyl)-4-[[4-[(2-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19673793 |
| Molecular Formula | C24H16ClI2NO4 |
| Molecular Weight | 671.66 g/mol |
| Exact Mass | 670.89 |
| IUPAC Name | (4Z)-2-(2-chloro-5-iodophenyl)-4-[[4-[(2-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3cc(I)ccc3Cl)OC2=O)ccc1OCc1ccccc1I |
| InChI | InChI=1S/C24H16ClI2NO4/c1-30-22-11-14(6-9-21(22)31-13-15-4-2-3-5-19(15)27)10-20-24(29)32-23(28-20)17-12-16(26)7-8-18(17)25/h2-12H,13H2,1H3/b20-10- |
| InChIKey | HJEOGAPZYSBOHO-JMIUGGIZSA-N |
| XLogP | 6.48 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|