About 1H-inden-1-yl hexanoate
1H-inden-1-yl hexanoate (PubChem CID 19688742) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1H-inden-1-yl hexanoate.
Molecular Properties
| Compound Name | 1H-inden-1-yl hexanoate |
| PubChem CID | 19688742 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1H-inden-1-yl hexanoate |
| SMILES | CCCCCC(=O)OC1C=Cc2ccccc21 |
| InChI | InChI=1S/C15H18O2/c1-2-3-4-9-15(16)17-14-11-10-12-7-5-6-8-13(12)14/h5-8,10-11,14H,2-4,9H2,1H3 |
| InChIKey | JINJGKBJESCJTM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-1-yl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-1-yl hexanoate?
The IUPAC name of 1H-inden-1-yl hexanoate (CID 19688742) is 1H-inden-1-yl hexanoate.
What is the SMILES notation for 1H-inden-1-yl hexanoate?
The canonical SMILES for 1H-inden-1-yl hexanoate is CCCCCC(=O)OC1C=Cc2ccccc21.
What is the InChIKey of 1H-inden-1-yl hexanoate?
The InChIKey is JINJGKBJESCJTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2/c1-2-3-4-9-15(16)17-14-11-10-12-7-5-6-8-13(12)14/h5-8,10-11,14H,2-4,9H2,1H3.
What are the key properties of 1H-inden-1-yl hexanoate?
1H-inden-1-yl hexanoate has a molecular weight of 230.31 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-yl hexanoate is sourced from PubChem (CID 19688742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).