C11H10Br6O2 — CID 19688998
1-methyl-2,3-bis(2,2,2-tribromoethoxy)benzene (PubChem CID 19688998) has the molecular formula C11H10Br6O2 and a molecular weight of 653.62 g/mol. Its IUPAC name is 1-methyl-2,3-bis(2,2,2-tribromoethoxy)benzene.
| Compound Name | 1-methyl-2,3-bis(2,2,2-tribromoethoxy)benzene |
|---|---|
| PubChem CID | 19688998 |
| Molecular Formula | C11H10Br6O2 |
| Molecular Weight | 653.62 g/mol |
| Exact Mass | 647.58 |
| IUPAC Name | 1-methyl-2,3-bis(2,2,2-tribromoethoxy)benzene |
| SMILES | Cc1cccc(OCC(Br)(Br)Br)c1OCC(Br)(Br)Br |
| InChI | InChI=1S/C11H10Br6O2/c1-7-3-2-4-8(18-5-10(12,13)14)9(7)19-6-11(15,16)17/h2-4H,5-6H2,1H3 |
| InChIKey | RYSHLAWOASURAZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|