C31H38N3O3S- — CID 19696591
4-benzhydryl-3-[[5-[tert-butyl(sulfinato)amino]-2-methoxyphenyl]methylamino]-1-azabicyclo[2.2.1]heptane (PubChem CID 19696591) has the molecular formula C31H38N3O3S- and a molecular weight of 532.73 g/mol. Its IUPAC name is 4-benzhydryl-3-[[5-[tert-butyl(sulfinato)amino]-2-methoxyphenyl]methylamino]-1-azabicyclo[2.2.1]heptane.
| Compound Name | 4-benzhydryl-3-[[5-[tert-butyl(sulfinato)amino]-2-methoxyphenyl]methylamino]-1-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 19696591 |
| Molecular Formula | C31H38N3O3S- |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 4-benzhydryl-3-[[5-[tert-butyl(sulfinato)amino]-2-methoxyphenyl]methylamino]-1-azabicyclo[2.2.1]heptane |
| SMILES | COc1ccc(N(S(=O)[O-])C(C)(C)C)cc1CNC1CN2CCC1(C(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C31H39N3O3S/c1-30(2,3)34(38(35)36)26-15-16-27(37-4)25(19-26)20-32-28-21-33-18-17-31(28,22-33)29(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-16,19,28-29,32H,17-18,20-22H2,1-4H3,(H,35,36)/p-1 |
| InChIKey | SHVVSNNNLADFAG-UHFFFAOYSA-M |
| XLogP | 5.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|