C34H44N3O3S- — CID 19696727
9-benzhydryl-8-[[5-[tert-butyl(sulfinato)amino]-2-methoxyphenyl]methylamino]-1-azabicyclo[5.2.1]decane (PubChem CID 19696727) has the molecular formula C34H44N3O3S- and a molecular weight of 574.81 g/mol. Its IUPAC name is 9-benzhydryl-8-[[5-[tert-butyl(sulfinato)amino]-2-methoxyphenyl]methylamino]-1-azabicyclo[5.2.1]decane.
| Compound Name | 9-benzhydryl-8-[[5-[tert-butyl(sulfinato)amino]-2-methoxyphenyl]methylamino]-1-azabicyclo[5.2.1]decane |
|---|---|
| PubChem CID | 19696727 |
| Molecular Formula | C34H44N3O3S- |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | 9-benzhydryl-8-[[5-[tert-butyl(sulfinato)amino]-2-methoxyphenyl]methylamino]-1-azabicyclo[5.2.1]decane |
| SMILES | COc1ccc(N(S(=O)[O-])C(C)(C)C)cc1CNC1C2CCCCCN(C2)C1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H45N3O3S/c1-34(2,3)37(41(38)39)29-19-20-30(40-4)28(22-29)23-35-32-27-18-12-7-13-21-36(24-27)33(32)31(25-14-8-5-9-15-25)26-16-10-6-11-17-26/h5-6,8-11,14-17,19-20,22,27,31-33,35H,7,12-13,18,21,23-24H2,1-4H3,(H,38,39)/p-1 |
| InChIKey | ZKPNBOAVICIMTF-UHFFFAOYSA-M |
| XLogP | 6.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|