C17H15N3O3 — CID 19700821
methyl 3-(6-ethyl-5-oxopyrido[2,3-d]pyridazin-8-yl)benzoate (PubChem CID 19700821) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is methyl 3-(6-ethyl-5-oxopyrido[2,3-d]pyridazin-8-yl)benzoate.
| Compound Name | methyl 3-(6-ethyl-5-oxopyrido[2,3-d]pyridazin-8-yl)benzoate |
|---|---|
| PubChem CID | 19700821 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | methyl 3-(6-ethyl-5-oxopyrido[2,3-d]pyridazin-8-yl)benzoate |
| SMILES | CCn1nc(-c2cccc(C(=O)OC)c2)c2ncccc2c1=O |
| InChI | InChI=1S/C17H15N3O3/c1-3-20-16(21)13-8-5-9-18-15(13)14(19-20)11-6-4-7-12(10-11)17(22)23-2/h4-10H,3H2,1-2H3 |
| InChIKey | YUVWWVMMQVKUMW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |