C28H22N4O2 — CID 108790850
2-ethyl-3-oxo-5,6-diphenyl-N-quinolin-8-ylpyridazine-4-carboxamide (PubChem CID 108790850) has the molecular formula C28H22N4O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-ethyl-3-oxo-5,6-diphenyl-N-quinolin-8-ylpyridazine-4-carboxamide.
| Compound Name | 2-ethyl-3-oxo-5,6-diphenyl-N-quinolin-8-ylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 108790850 |
| Molecular Formula | C28H22N4O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-ethyl-3-oxo-5,6-diphenyl-N-quinolin-8-ylpyridazine-4-carboxamide |
| SMILES | CCn1nc(-c2ccccc2)c(-c2ccccc2)c(C(=O)Nc2cccc3cccnc23)c1=O |
| InChI | InChI=1S/C28H22N4O2/c1-2-32-28(34)24(27(33)30-22-17-9-15-20-16-10-18-29-25(20)22)23(19-11-5-3-6-12-19)26(31-32)21-13-7-4-8-14-21/h3-18H,2H2,1H3,(H,30,33) |
| InChIKey | DDORTCCFKQMNCR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |