C27H25N3O4 — CID 108790773
N-(2,5-dimethoxyphenyl)-2-ethyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide (PubChem CID 108790773) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-ethyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-ethyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 108790773 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-ethyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
| SMILES | CCn1nc(-c2ccccc2)c(-c2ccccc2)c(C(=O)Nc2cc(OC)ccc2OC)c1=O |
| InChI | InChI=1S/C27H25N3O4/c1-4-30-27(32)24(26(31)28-21-17-20(33-2)15-16-22(21)34-3)23(18-11-7-5-8-12-18)25(29-30)19-13-9-6-10-14-19/h5-17H,4H2,1-3H3,(H,28,31) |
| InChIKey | IBNUPLBMSAEGNN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |