C26H21N3O5 — CID 108803452
4-[(2-ethyl-3-oxo-5,6-diphenylpyridazine-4-carbonyl)amino]-2-hydroxybenzoic acid (PubChem CID 108803452) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is 4-[(2-ethyl-3-oxo-5,6-diphenylpyridazine-4-carbonyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(2-ethyl-3-oxo-5,6-diphenylpyridazine-4-carbonyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108803452 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 4-[(2-ethyl-3-oxo-5,6-diphenylpyridazine-4-carbonyl)amino]-2-hydroxybenzoic acid |
| SMILES | CCn1nc(-c2ccccc2)c(-c2ccccc2)c(C(=O)Nc2ccc(C(=O)O)c(O)c2)c1=O |
| InChI | InChI=1S/C26H21N3O5/c1-2-29-25(32)22(24(31)27-18-13-14-19(26(33)34)20(30)15-18)21(16-9-5-3-6-10-16)23(28-29)17-11-7-4-8-12-17/h3-15,30H,2H2,1H3,(H,27,31)(H,33,34) |
| InChIKey | QTPIBIOOQQBJDL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |