C22H23N3O4 — CID 10069141
5-acetyl-4-(2,5-dimethoxyanilino)-2-ethyl-6-phenylpyridazin-3-one (PubChem CID 10069141) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 5-acetyl-4-(2,5-dimethoxyanilino)-2-ethyl-6-phenylpyridazin-3-one.
| Compound Name | 5-acetyl-4-(2,5-dimethoxyanilino)-2-ethyl-6-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 10069141 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-acetyl-4-(2,5-dimethoxyanilino)-2-ethyl-6-phenylpyridazin-3-one |
| SMILES | CCn1nc(-c2ccccc2)c(C(C)=O)c(Nc2cc(OC)ccc2OC)c1=O |
| InChI | InChI=1S/C22H23N3O4/c1-5-25-22(27)21(23-17-13-16(28-3)11-12-18(17)29-4)19(14(2)26)20(24-25)15-9-7-6-8-10-15/h6-13,23H,5H2,1-4H3 |
| InChIKey | GKDQLKGXMFBCGV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |