C24H20N4O5 — CID 69142730
[5-[(5-acetyl-2-ethyl-3-oxo-6-phenylpyridazin-4-yl)amino]quinolin-8-yl] hydrogen carbonate (PubChem CID 69142730) has the molecular formula C24H20N4O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is [5-[(5-acetyl-2-ethyl-3-oxo-6-phenylpyridazin-4-yl)amino]quinolin-8-yl] hydrogen carbonate.
| Compound Name | [5-[(5-acetyl-2-ethyl-3-oxo-6-phenylpyridazin-4-yl)amino]quinolin-8-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 69142730 |
| Molecular Formula | C24H20N4O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [5-[(5-acetyl-2-ethyl-3-oxo-6-phenylpyridazin-4-yl)amino]quinolin-8-yl] hydrogen carbonate |
| SMILES | CCn1nc(-c2ccccc2)c(C(C)=O)c(Nc2ccc(OC(=O)O)c3ncccc23)c1=O |
| InChI | InChI=1S/C24H20N4O5/c1-3-28-23(30)22(19(14(2)29)20(27-28)15-8-5-4-6-9-15)26-17-11-12-18(33-24(31)32)21-16(17)10-7-13-25-21/h4-13,26H,3H2,1-2H3,(H,31,32) |
| InChIKey | VYHYVFDWZWWTCD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|