About propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate
propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate (PubChem CID 68897361) has the molecular formula C23H24N4O5
and a molecular weight of 436.47 g/mol. Its IUPAC name is propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate.
Molecular Properties
| Compound Name | propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate |
| PubChem CID | 68897361 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate |
| SMILES | CCC(=O)OCOC(=O)c1c(-c2ccccc2)nn(CC)c(=O)c1Nc1cnccc1C |
| InChI | InChI=1S/C23H24N4O5/c1-4-18(28)31-14-32-23(30)19-20(16-9-7-6-8-10-16)26-27(5-2)22(29)21(19)25-17-13-24-12-11-15(17)3/h6-13,25H,4-5,14H2,1-3H3 |
| InChIKey | VBFNLZGQWGEJFO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate?
The IUPAC name of propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate (CID 68897361) is propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate.
What is the SMILES notation for propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate?
The canonical SMILES for propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate is CCC(=O)OCOC(=O)c1c(-c2ccccc2)nn(CC)c(=O)c1Nc1cnccc1C.
What is the InChIKey of propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate?
The InChIKey is VBFNLZGQWGEJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O5/c1-4-18(28)31-14-32-23(30)19-20(16-9-7-6-8-10-16)26-27(5-2)22(29)21(19)25-17-13-24-12-11-15(17)3/h6-13,25H,4-5,14H2,1-3H3.
What are the key properties of propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate?
propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate has a molecular weight of 436.47 g/mol, XLogP of 3.44, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyloxymethyl 1-ethyl-5-[(4-methyl-3-pyridinyl)amino]-6-oxo-3-phenylpyridazine-4-carboxylate is sourced from PubChem (CID 68897361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).