C26H27FN4O6 — CID 68893658
cyclohexyloxycarbonyloxymethyl 1-ethyl-3-(4-fluorophenyl)-6-oxo-5-(pyridin-3-ylamino)pyridazine-4-carboxylate (PubChem CID 68893658) has the molecular formula C26H27FN4O6 and a molecular weight of 510.52 g/mol. Its IUPAC name is cyclohexyloxycarbonyloxymethyl 1-ethyl-3-(4-fluorophenyl)-6-oxo-5-(pyridin-3-ylamino)pyridazine-4-carboxylate.
| Compound Name | cyclohexyloxycarbonyloxymethyl 1-ethyl-3-(4-fluorophenyl)-6-oxo-5-(pyridin-3-ylamino)pyridazine-4-carboxylate |
|---|---|
| PubChem CID | 68893658 |
| Molecular Formula | C26H27FN4O6 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | cyclohexyloxycarbonyloxymethyl 1-ethyl-3-(4-fluorophenyl)-6-oxo-5-(pyridin-3-ylamino)pyridazine-4-carboxylate |
| SMILES | CCn1nc(-c2ccc(F)cc2)c(C(=O)OCOC(=O)OC2CCCCC2)c(Nc2cccnc2)c1=O |
| InChI | InChI=1S/C26H27FN4O6/c1-2-31-24(32)23(29-19-7-6-14-28-15-19)21(22(30-31)17-10-12-18(27)13-11-17)25(33)35-16-36-26(34)37-20-8-4-3-5-9-20/h6-7,10-15,20,29H,2-5,8-9,16H2,1H3 |
| InChIKey | BZTJGDLEETYBDM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|