C24H28N4O5S — CID 11504004
(6-ethoxy-6-oxohexyl) 1-ethyl-6-oxo-5-(pyridin-3-ylamino)-3-thiophen-2-ylpyridazine-4-carboxylate (PubChem CID 11504004) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is (6-ethoxy-6-oxohexyl) 1-ethyl-6-oxo-5-(pyridin-3-ylamino)-3-thiophen-2-ylpyridazine-4-carboxylate.
| Compound Name | (6-ethoxy-6-oxohexyl) 1-ethyl-6-oxo-5-(pyridin-3-ylamino)-3-thiophen-2-ylpyridazine-4-carboxylate |
|---|---|
| PubChem CID | 11504004 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (6-ethoxy-6-oxohexyl) 1-ethyl-6-oxo-5-(pyridin-3-ylamino)-3-thiophen-2-ylpyridazine-4-carboxylate |
| SMILES | CCOC(=O)CCCCCOC(=O)c1c(-c2cccs2)nn(CC)c(=O)c1Nc1cccnc1 |
| InChI | InChI=1S/C24H28N4O5S/c1-3-28-23(30)22(26-17-10-8-13-25-16-17)20(21(27-28)18-11-9-15-34-18)24(31)33-14-7-5-6-12-19(29)32-4-2/h8-11,13,15-16,26H,3-7,12,14H2,1-2H3 |
| InChIKey | QEMJCZNMKBWERK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|