C24H26N4O6S — CID 68894674
cyclohexyloxycarbonyloxymethyl 1-ethyl-6-oxo-5-(pyridin-3-ylamino)-3-thiophen-3-ylpyridazine-4-carboxylate (PubChem CID 68894674) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is cyclohexyloxycarbonyloxymethyl 1-ethyl-6-oxo-5-(pyridin-3-ylamino)-3-thiophen-3-ylpyridazine-4-carboxylate.
| Compound Name | cyclohexyloxycarbonyloxymethyl 1-ethyl-6-oxo-5-(pyridin-3-ylamino)-3-thiophen-3-ylpyridazine-4-carboxylate |
|---|---|
| PubChem CID | 68894674 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | cyclohexyloxycarbonyloxymethyl 1-ethyl-6-oxo-5-(pyridin-3-ylamino)-3-thiophen-3-ylpyridazine-4-carboxylate |
| SMILES | CCn1nc(-c2ccsc2)c(C(=O)OCOC(=O)OC2CCCCC2)c(Nc2cccnc2)c1=O |
| InChI | InChI=1S/C24H26N4O6S/c1-2-28-22(29)21(26-17-7-6-11-25-13-17)19(20(27-28)16-10-12-35-14-16)23(30)32-15-33-24(31)34-18-8-4-3-5-9-18/h6-7,10-14,18,26H,2-5,8-9,15H2,1H3 |
| InChIKey | KISFQSUTGWDZJL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|