C8H6ClN2O5P — CID 19701293
5-chloro-2-phosphonoimidazo[1,2-a]pyridine-6-carboxylic acid (PubChem CID 19701293) has the molecular formula C8H6ClN2O5P and a molecular weight of 276.57 g/mol. Its IUPAC name is 5-chloro-2-phosphonoimidazo[1,2-a]pyridine-6-carboxylic acid.
| Compound Name | 5-chloro-2-phosphonoimidazo[1,2-a]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 19701293 |
| Molecular Formula | C8H6ClN2O5P |
| Molecular Weight | 276.57 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 5-chloro-2-phosphonoimidazo[1,2-a]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(P(=O)(O)O)cn2c1Cl |
| InChI | InChI=1S/C8H6ClN2O5P/c9-7-4(8(12)13)1-2-5-10-6(3-11(5)7)17(14,15)16/h1-3H,(H,12,13)(H2,14,15,16) |
| InChIKey | SYLSFJCXYIQNQW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.57 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|