C14H12BrCl2N3S — CID 19703970
1-(3-bromo-2-pyridinyl)-3-[2-(2,6-dichlorophenyl)ethyl]thiourea (PubChem CID 19703970) has the molecular formula C14H12BrCl2N3S and a molecular weight of 405.15 g/mol. Its IUPAC name is 1-(3-bromo-2-pyridinyl)-3-[2-(2,6-dichlorophenyl)ethyl]thiourea.
| Compound Name | 1-(3-bromo-2-pyridinyl)-3-[2-(2,6-dichlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19703970 |
| Molecular Formula | C14H12BrCl2N3S |
| Molecular Weight | 405.15 g/mol |
| Exact Mass | 402.93 |
| IUPAC Name | 1-(3-bromo-2-pyridinyl)-3-[2-(2,6-dichlorophenyl)ethyl]thiourea |
| SMILES | S=C(NCCc1c(Cl)cccc1Cl)Nc1ncccc1Br |
| InChI | InChI=1S/C14H12BrCl2N3S/c15-10-3-2-7-18-13(10)20-14(21)19-8-6-9-11(16)4-1-5-12(9)17/h1-5,7H,6,8H2,(H2,18,19,20,21) |
| InChIKey | PMUMLKQUYFRQQL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.15 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|