C15H16N4O — CID 19705274
(2,4-diamino-5,6,7,8-tetrahydroquinazolin-6-yl)-phenylmethanone (PubChem CID 19705274) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is (2,4-diamino-5,6,7,8-tetrahydroquinazolin-6-yl)-phenylmethanone.
| Compound Name | (2,4-diamino-5,6,7,8-tetrahydroquinazolin-6-yl)-phenylmethanone |
|---|---|
| PubChem CID | 19705274 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (2,4-diamino-5,6,7,8-tetrahydroquinazolin-6-yl)-phenylmethanone |
| SMILES | Nc1nc(N)c2c(n1)CCC(C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C15H16N4O/c16-14-11-8-10(6-7-12(11)18-15(17)19-14)13(20)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H4,16,17,18,19) |
| InChIKey | IPWIUOPIEFWKFA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |