C13H14N4 — CID 43134542
7-phenyl-5,6,7,8-tetrahydro-1,2,4-benzotriazin-3-amine (PubChem CID 43134542) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 7-phenyl-5,6,7,8-tetrahydro-1,2,4-benzotriazin-3-amine.
| Compound Name | 7-phenyl-5,6,7,8-tetrahydro-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 43134542 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 7-phenyl-5,6,7,8-tetrahydro-1,2,4-benzotriazin-3-amine |
| SMILES | Nc1nnc2c(n1)CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C13H14N4/c14-13-15-11-7-6-10(8-12(11)16-17-13)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,14,15,17) |
| InChIKey | IGPNYFVPDVPCLU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |