C17H15ClN2 — CID 103095140
4-chloro-7-phenyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole (PubChem CID 103095140) has the molecular formula C17H15ClN2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-chloro-7-phenyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole.
| Compound Name | 4-chloro-7-phenyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 103095140 |
| Molecular Formula | C17H15ClN2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-chloro-7-phenyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole |
| SMILES | Clc1cccn2c3c(nc12)CC(c1ccccc1)CC3 |
| InChI | InChI=1S/C17H15ClN2/c18-14-7-4-10-20-16-9-8-13(11-15(16)19-17(14)20)12-5-2-1-3-6-12/h1-7,10,13H,8-9,11H2 |
| InChIKey | UZSXZILMTDJNDC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |