C18H22N2O — CID 139771111
6-phenyl-3-piperidin-1-yl-4,5,6,7-tetrahydro-2,1-benzoxazole (PubChem CID 139771111) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 6-phenyl-3-piperidin-1-yl-4,5,6,7-tetrahydro-2,1-benzoxazole.
| Compound Name | 6-phenyl-3-piperidin-1-yl-4,5,6,7-tetrahydro-2,1-benzoxazole |
|---|---|
| PubChem CID | 139771111 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 6-phenyl-3-piperidin-1-yl-4,5,6,7-tetrahydro-2,1-benzoxazole |
| SMILES | c1ccc(C2CCc3c(noc3N3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-3-7-14(8-4-1)15-9-10-16-17(13-15)19-21-18(16)20-11-5-2-6-12-20/h1,3-4,7-8,15H,2,5-6,9-13H2 |
| InChIKey | NKEXBBDGTSFITL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |