C35H43Cl2N2O2+ — CID 19705319
N-[2-(3,4-dichlorophenyl)-4-(4-phenyl-1-azoniabicyclo[2.2.2]octan-1-yl)butyl]-N-methyl-2-(3-propan-2-yloxyphenyl)acetamide (PubChem CID 19705319) has the molecular formula C35H43Cl2N2O2+ and a molecular weight of 594.65 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-4-(4-phenyl-1-azoniabicyclo[2.2.2]octan-1-yl)butyl]-N-methyl-2-(3-propan-2-yloxyphenyl)acetamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-4-(4-phenyl-1-azoniabicyclo[2.2.2]octan-1-yl)butyl]-N-methyl-2-(3-propan-2-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 19705319 |
| Molecular Formula | C35H43Cl2N2O2+ |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-4-(4-phenyl-1-azoniabicyclo[2.2.2]octan-1-yl)butyl]-N-methyl-2-(3-propan-2-yloxyphenyl)acetamide |
| SMILES | CC(C)Oc1cccc(CC(=O)N(C)CC(CC[N+]23CCC(c4ccccc4)(CC2)CC3)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C35H43Cl2N2O2/c1-26(2)41-31-11-7-8-27(22-31)23-34(40)38(3)25-29(28-12-13-32(36)33(37)24-28)14-18-39-19-15-35(16-20-39,17-21-39)30-9-5-4-6-10-30/h4-13,22,24,26,29H,14-21,23,25H2,1-3H3/q+1 |
| InChIKey | KNHGRTXKIQTMPP-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|