C32H43Cl2N2O+ — CID 67627097
N-[4-(4-cyclohexyl-1-azoniabicyclo[2.2.2]octan-1-yl)-2-(3,4-dichlorophenyl)butyl]-N-methyl-2-phenylacetamide (PubChem CID 67627097) has the molecular formula C32H43Cl2N2O+ and a molecular weight of 542.62 g/mol. Its IUPAC name is N-[4-(4-cyclohexyl-1-azoniabicyclo[2.2.2]octan-1-yl)-2-(3,4-dichlorophenyl)butyl]-N-methyl-2-phenylacetamide.
| Compound Name | N-[4-(4-cyclohexyl-1-azoniabicyclo[2.2.2]octan-1-yl)-2-(3,4-dichlorophenyl)butyl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 67627097 |
| Molecular Formula | C32H43Cl2N2O+ |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | N-[4-(4-cyclohexyl-1-azoniabicyclo[2.2.2]octan-1-yl)-2-(3,4-dichlorophenyl)butyl]-N-methyl-2-phenylacetamide |
| SMILES | CN(CC(CC[N+]12CCC(C3CCCCC3)(CC1)CC2)c1ccc(Cl)c(Cl)c1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C32H43Cl2N2O/c1-35(31(37)22-25-8-4-2-5-9-25)24-27(26-12-13-29(33)30(34)23-26)14-18-36-19-15-32(16-20-36,17-21-36)28-10-6-3-7-11-28/h2,4-5,8-9,12-13,23,27-28H,3,6-7,10-11,14-22,24H2,1H3/q+1 |
| InChIKey | OULUDFATEAFXCK-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|