C35H41Cl2F4N3O4S — CID 22613797
[1-[4-(4-cyclohexyl-1-azoniabicyclo[2.2.2]octan-1-yl)-2-(3,4-dichlorophenyl)butyl]imidazol-2-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone;methanesulfonate (PubChem CID 22613797) has the molecular formula C35H41Cl2F4N3O4S and a molecular weight of 746.70 g/mol. Its IUPAC name is [1-[4-(4-cyclohexyl-1-azoniabicyclo[2.2.2]octan-1-yl)-2-(3,4-dichlorophenyl)butyl]imidazol-2-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone;methanesulfonate.
| Compound Name | [1-[4-(4-cyclohexyl-1-azoniabicyclo[2.2.2]octan-1-yl)-2-(3,4-dichlorophenyl)butyl]imidazol-2-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone;methanesulfonate |
|---|---|
| PubChem CID | 22613797 |
| Molecular Formula | C35H41Cl2F4N3O4S |
| Molecular Weight | 746.70 g/mol |
| Exact Mass | 745.21 |
| IUPAC Name | [1-[4-(4-cyclohexyl-1-azoniabicyclo[2.2.2]octan-1-yl)-2-(3,4-dichlorophenyl)butyl]imidazol-2-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].O=C(c1ccc(F)c(C(F)(F)F)c1)c1nccn1CC(CC[N+]12CCC(C3CCCCC3)(CC1)CC2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C34H38Cl2F4N3O.CH4O3S/c35-28-8-6-23(21-29(28)36)25(10-16-43-17-11-33(12-18-43,13-19-43)26-4-2-1-3-5-26)22-42-15-14-41-32(42)31(44)24-7-9-30(37)27(20-24)34(38,39)40;1-5(2,3)4/h6-9,14-15,20-21,25-26H,1-5,10-13,16-19,22H2;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | WFLTWNGQHSIJLB-UHFFFAOYSA-M |
| XLogP | 8.50 |
| TPSA | 92.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.70 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|