C22H22ClN5O3S — CID 19707163
5-[5-(2-chlorophenyl)tetrazol-2-yl]-4-oxo-3-(4-phenylbutanethioylamino)pentanoic acid (PubChem CID 19707163) has the molecular formula C22H22ClN5O3S and a molecular weight of 471.97 g/mol. Its IUPAC name is 5-[5-(2-chlorophenyl)tetrazol-2-yl]-4-oxo-3-(4-phenylbutanethioylamino)pentanoic acid.
| Compound Name | 5-[5-(2-chlorophenyl)tetrazol-2-yl]-4-oxo-3-(4-phenylbutanethioylamino)pentanoic acid |
|---|---|
| PubChem CID | 19707163 |
| Molecular Formula | C22H22ClN5O3S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 5-[5-(2-chlorophenyl)tetrazol-2-yl]-4-oxo-3-(4-phenylbutanethioylamino)pentanoic acid |
| SMILES | O=C(O)CC(NC(=S)CCCc1ccccc1)C(=O)Cn1nnc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C22H22ClN5O3S/c23-17-11-5-4-10-16(17)22-25-27-28(26-22)14-19(29)18(13-21(30)31)24-20(32)12-6-9-15-7-2-1-3-8-15/h1-5,7-8,10-11,18H,6,9,12-14H2,(H,24,32)(H,30,31) |
| InChIKey | JYTPGOCQLDXUGA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|