C15H18BrNO — CID 19707361
8-bromo-6,6-dimethyl-1,2,4,4a,5,10b-hexahydrobenzo[f]quinolin-3-one (PubChem CID 19707361) has the molecular formula C15H18BrNO and a molecular weight of 308.22 g/mol. Its IUPAC name is 8-bromo-6,6-dimethyl-1,2,4,4a,5,10b-hexahydrobenzo[f]quinolin-3-one.
| Compound Name | 8-bromo-6,6-dimethyl-1,2,4,4a,5,10b-hexahydrobenzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 19707361 |
| Molecular Formula | C15H18BrNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 8-bromo-6,6-dimethyl-1,2,4,4a,5,10b-hexahydrobenzo[f]quinolin-3-one |
| SMILES | CC1(C)CC2NC(=O)CCC2c2ccc(Br)cc21 |
| InChI | InChI=1S/C15H18BrNO/c1-15(2)8-13-11(5-6-14(18)17-13)10-4-3-9(16)7-12(10)15/h3-4,7,11,13H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | OXJGTSBFTXNAFO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |