C32H28F2N6O4S — CID 19711291
4-[5-[(3,4-difluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-N-[4-[2-[[2-hydroxy-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethyl]amino]ethyl]phenyl]benzenesulfonamide (PubChem CID 19711291) has the molecular formula C32H28F2N6O4S and a molecular weight of 630.68 g/mol. Its IUPAC name is 4-[5-[(3,4-difluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-N-[4-[2-[[2-hydroxy-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethyl]amino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 4-[5-[(3,4-difluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-N-[4-[2-[[2-hydroxy-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethyl]amino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19711291 |
| Molecular Formula | C32H28F2N6O4S |
| Molecular Weight | 630.68 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 4-[5-[(3,4-difluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-N-[4-[2-[[2-hydroxy-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethyl]amino]ethyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CCNCC(O)c2cnc3[nH]ccc3c2)cc1)c1ccc(-c2noc(Cc3ccc(F)c(F)c3)n2)cc1 |
| InChI | InChI=1S/C32H28F2N6O4S/c33-27-10-3-21(15-28(27)34)16-30-38-32(39-44-30)22-4-8-26(9-5-22)45(42,43)40-25-6-1-20(2-7-25)11-13-35-19-29(41)24-17-23-12-14-36-31(23)37-18-24/h1-10,12,14-15,17-18,29,35,40-41H,11,13,16,19H2,(H,36,37) |
| InChIKey | UPCFMSZKMKGXSF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 146.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|