C23H26N2O2 — CID 19715596
cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid (PubChem CID 19715596) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid.
| Compound Name | cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 19715596 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid |
| SMILES | Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)O.NC1CCCCC1 |
| InChI | InChI=1S/C17H13NO2.C6H13N/c1-11-15(17(19)20)13-9-5-6-10-14(13)18-16(11)12-7-3-2-4-8-12;7-6-4-2-1-3-5-6/h2-10H,1H3,(H,19,20);6H,1-5,7H2 |
| InChIKey | ACVWZHACEAFOGW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |