cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid

C23H26N2O2 — CID 19715596

IUPACcyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid
SMILESCc1c(-c2ccccc2)nc2ccccc2c1C(=O)O.NC1CCCCC1
InChIInChI=1S/C17H13NO2.C6H13N/c1-11-15(17(19)20)13-9-5-6-10-14(13)18-16(11)12-7-3-2-4-8-12;7-6-4-2-1-3-5-6/h2-10H,1H3,(H,19,20);6H,1-5,7H2
InChIKeyACVWZHACEAFOGW-UHFFFAOYSA-N
MW362.47 g/mol
LogP5.19
Rot. Bonds2

About cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid

cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid (PubChem CID 19715596) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid.

Molecular Properties

Compound Namecyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid
PubChem CID19715596
Molecular FormulaC23H26N2O2
Molecular Weight362.47 g/mol
Exact Mass362.20
IUPAC Namecyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid
SMILESCc1c(-c2ccccc2)nc2ccccc2c1C(=O)O.NC1CCCCC1
InChIInChI=1S/C17H13NO2.C6H13N/c1-11-15(17(19)20)13-9-5-6-10-14(13)18-16(11)12-7-3-2-4-8-12;7-6-4-2-1-3-5-6/h2-10H,1H3,(H,19,20);6H,1-5,7H2
InChIKeyACVWZHACEAFOGW-UHFFFAOYSA-N
XLogP5.19
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500362.47
LogP ≤ 55.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid?
The IUPAC name of cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid (CID 19715596) is cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid.
What is the SMILES notation for cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid?
The canonical SMILES for cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid is Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)O.NC1CCCCC1.
What is the InChIKey of cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid?
The InChIKey is ACVWZHACEAFOGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2.C6H13N/c1-11-15(17(19)20)13-9-5-6-10-14(13)18-16(11)12-7-3-2-4-8-12;7-6-4-2-1-3-5-6/h2-10H,1H3,(H,19,20);6H,1-5,7H2.
What are the key properties of cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid?
cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid has a molecular weight of 362.47 g/mol, XLogP of 5.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;3-methyl-2-phenylquinoline-4-carboxylic acid is sourced from PubChem (CID 19715596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).