C21H19NO2 — CID 122539386
6-cyclobutyl-3-methyl-2-phenylquinoline-4-carboxylic acid (PubChem CID 122539386) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-cyclobutyl-3-methyl-2-phenylquinoline-4-carboxylic acid.
| Compound Name | 6-cyclobutyl-3-methyl-2-phenylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 122539386 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 6-cyclobutyl-3-methyl-2-phenylquinoline-4-carboxylic acid |
| SMILES | Cc1c(-c2ccccc2)nc2ccc(C3CCC3)cc2c1C(=O)O |
| InChI | InChI=1S/C21H19NO2/c1-13-19(21(23)24)17-12-16(14-8-5-9-14)10-11-18(17)22-20(13)15-6-3-2-4-7-15/h2-4,6-7,10-12,14H,5,8-9H2,1H3,(H,23,24) |
| InChIKey | BJKQUBQJTJEHFZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |