C21H26N6O2S3 — CID 19721709
2-[[2-[[5-(4-ethyl-5-methylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 19721709) has the molecular formula C21H26N6O2S3 and a molecular weight of 490.68 g/mol. Its IUPAC name is 2-[[2-[[5-(4-ethyl-5-methylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[2-[[5-(4-ethyl-5-methylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 19721709 |
| Molecular Formula | C21H26N6O2S3 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-[[2-[[5-(4-ethyl-5-methylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nc(C)c(C(=O)N(C)C)s2)nnc1-c1csc(C)c1CC |
| InChI | InChI=1S/C21H26N6O2S3/c1-7-9-27-18(15-10-30-13(4)14(15)8-2)24-25-21(27)31-11-16(28)23-20-22-12(3)17(32-20)19(29)26(5)6/h7,10H,1,8-9,11H2,2-6H3,(H,22,23,28) |
| InChIKey | CCLKEYLTZSWVSN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|