C19H24N6O2S3 — CID 19721473
2-[[2-[[5-(4-ethyl-5-methylthiophen-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 19721473) has the molecular formula C19H24N6O2S3 and a molecular weight of 464.64 g/mol. Its IUPAC name is 2-[[2-[[5-(4-ethyl-5-methylthiophen-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[2-[[5-(4-ethyl-5-methylthiophen-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 19721473 |
| Molecular Formula | C19H24N6O2S3 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-[[2-[[5-(4-ethyl-5-methylthiophen-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1c(-c2nnc(SCC(=O)Nc3nc(C)c(C(=O)N(C)C)s3)n2C)csc1C |
| InChI | InChI=1S/C19H24N6O2S3/c1-7-12-11(3)28-8-13(12)16-22-23-19(25(16)6)29-9-14(26)21-18-20-10(2)15(30-18)17(27)24(4)5/h8H,7,9H2,1-6H3,(H,20,21,26) |
| InChIKey | UZBFZRBYTOGAHJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |