C21H28N6O2S3 — CID 19720410
N,N,4-trimethyl-2-[[2-[[5-(5-propan-2-ylthiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 19720410) has the molecular formula C21H28N6O2S3 and a molecular weight of 492.70 g/mol. Its IUPAC name is N,N,4-trimethyl-2-[[2-[[5-(5-propan-2-ylthiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N,N,4-trimethyl-2-[[2-[[5-(5-propan-2-ylthiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 19720410 |
| Molecular Formula | C21H28N6O2S3 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | N,N,4-trimethyl-2-[[2-[[5-(5-propan-2-ylthiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | CCCn1c(SCC(=O)Nc2nc(C)c(C(=O)N(C)C)s2)nnc1-c1csc(C(C)C)c1 |
| InChI | InChI=1S/C21H28N6O2S3/c1-7-8-27-18(14-9-15(12(2)3)30-10-14)24-25-21(27)31-11-16(28)23-20-22-13(4)17(32-20)19(29)26(5)6/h9-10,12H,7-8,11H2,1-6H3,(H,22,23,28) |
| InChIKey | COYIUWRTYFWENN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |