C24H32N6O3S2 — CID 17255064
2-[[2-[[4-ethyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 17255064) has the molecular formula C24H32N6O3S2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 2-[[2-[[4-ethyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[2-[[4-ethyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 17255064 |
| Molecular Formula | C24H32N6O3S2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 2-[[2-[[4-ethyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCn1c(SCC(=O)Nc2nc(C)c(C(=O)N(C)C)s2)nnc1C(C)Oc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C24H32N6O3S2/c1-8-30-21(16(5)33-18-11-9-17(10-12-18)14(2)3)27-28-24(30)34-13-19(31)26-23-25-15(4)20(35-23)22(32)29(6)7/h9-12,14,16H,8,13H2,1-7H3,(H,25,26,31) |
| InChIKey | IDPZLCUHQVPHFZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |