C20H23FN6O3S2 — CID 19640426
2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 19640426) has the molecular formula C20H23FN6O3S2 and a molecular weight of 478.58 g/mol. Its IUPAC name is 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 19640426 |
| Molecular Formula | C20H23FN6O3S2 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)CSc2nnc(C(C)Oc3ccc(F)cc3)n2C)sc1C(=O)N(C)C |
| InChI | InChI=1S/C20H23FN6O3S2/c1-11-16(18(29)26(3)4)32-19(22-11)23-15(28)10-31-20-25-24-17(27(20)5)12(2)30-14-8-6-13(21)7-9-14/h6-9,12H,10H2,1-5H3,(H,22,23,28) |
| InChIKey | FHWQVGPBXBKTGW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |