C23H28N6O3S2 — CID 19636692
N,N,4-trimethyl-2-[[2-[[5-[1-(4-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 19636692) has the molecular formula C23H28N6O3S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is N,N,4-trimethyl-2-[[2-[[5-[1-(4-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N,N,4-trimethyl-2-[[2-[[5-[1-(4-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 19636692 |
| Molecular Formula | C23H28N6O3S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | N,N,4-trimethyl-2-[[2-[[5-[1-(4-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nc(C)c(C(=O)N(C)C)s2)nnc1C(C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C23H28N6O3S2/c1-7-12-29-20(16(4)32-17-10-8-14(2)9-11-17)26-27-23(29)33-13-18(30)25-22-24-15(3)19(34-22)21(31)28(5)6/h7-11,16H,1,12-13H2,2-6H3,(H,24,25,30) |
| InChIKey | AAOWEXFDYJICOD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|