C22H29N7O2S2 — CID 19641741
2-[[2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 19641741) has the molecular formula C22H29N7O2S2 and a molecular weight of 487.66 g/mol. Its IUPAC name is 2-[[2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 19641741 |
| Molecular Formula | C22H29N7O2S2 |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[[2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC)c1ccc(-c2nnc(SCC(=O)Nc3nc(C)c(C(=O)N(C)C)s3)n2C)cc1 |
| InChI | InChI=1S/C22H29N7O2S2/c1-7-29(8-2)16-11-9-15(10-12-16)19-25-26-22(28(19)6)32-13-17(30)24-21-23-14(3)18(33-21)20(31)27(4)5/h9-12H,7-8,13H2,1-6H3,(H,23,24,30) |
| InChIKey | DRKNFAVEUUQINN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |